C18H11Cl2FN4O2 — CID 110525875
N-[(E)-(2,3-dichlorophenyl)methylideneamino]-4-(4-fluorophenyl)-2-oxo-1H-pyrimidine-6-carboxamide (PubChem CID 110525875) has the molecular formula C18H11Cl2FN4O2 and a molecular weight of 405.22 g/mol. Its IUPAC name is N-[(E)-(2,3-dichlorophenyl)methylideneamino]-4-(4-fluorophenyl)-2-oxo-1H-pyrimidine-6-carboxamide.
| Compound Name | N-[(E)-(2,3-dichlorophenyl)methylideneamino]-4-(4-fluorophenyl)-2-oxo-1H-pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 110525875 |
| Molecular Formula | C18H11Cl2FN4O2 |
| Molecular Weight | 405.22 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | N-[(E)-(2,3-dichlorophenyl)methylideneamino]-4-(4-fluorophenyl)-2-oxo-1H-pyrimidine-6-carboxamide |
| SMILES | O=C(N/N=C/c1cccc(Cl)c1Cl)c1cc(-c2ccc(F)cc2)nc(=O)[nH]1 |
| InChI | InChI=1S/C18H11Cl2FN4O2/c19-13-3-1-2-11(16(13)20)9-22-25-17(26)15-8-14(23-18(27)24-15)10-4-6-12(21)7-5-10/h1-9H,(H,25,26)(H,23,24,27)/b22-9+ |
| InChIKey | RAANVLVAMHFKRS-LSFURLLWSA-N |
| XLogP | 3.65 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.22 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|