C31H19Br2N3O5 — CID 56698301
[2-(4-bromobenzoyl)oxy-4-[(E)-(quinoline-2-carbonylhydrazinylidene)methyl]phenyl] 4-bromobenzoate (PubChem CID 56698301) has the molecular formula C31H19Br2N3O5 and a molecular weight of 673.32 g/mol. Its IUPAC name is [2-(4-bromobenzoyl)oxy-4-[(E)-(quinoline-2-carbonylhydrazinylidene)methyl]phenyl] 4-bromobenzoate.
| Compound Name | [2-(4-bromobenzoyl)oxy-4-[(E)-(quinoline-2-carbonylhydrazinylidene)methyl]phenyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 56698301 |
| Molecular Formula | C31H19Br2N3O5 |
| Molecular Weight | 673.32 g/mol |
| Exact Mass | 670.97 |
| IUPAC Name | [2-(4-bromobenzoyl)oxy-4-[(E)-(quinoline-2-carbonylhydrazinylidene)methyl]phenyl] 4-bromobenzoate |
| SMILES | O=C(Oc1ccc(/C=N/NC(=O)c2ccc3ccccc3n2)cc1OC(=O)c1ccc(Br)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C31H19Br2N3O5/c32-23-11-6-21(7-12-23)30(38)40-27-16-5-19(17-28(27)41-31(39)22-8-13-24(33)14-9-22)18-34-36-29(37)26-15-10-20-3-1-2-4-25(20)35-26/h1-18H,(H,36,37)/b34-18+ |
| InChIKey | UBEHNRZYUIDBES-FABQOPTDSA-N |
| XLogP | 6.96 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.32 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|