C25H19ClN4O4 — CID 54571447
N-[4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]-2-methoxyphenyl]quinoline-2-carboxamide (PubChem CID 54571447) has the molecular formula C25H19ClN4O4 and a molecular weight of 474.90 g/mol. Its IUPAC name is N-[4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]-2-methoxyphenyl]quinoline-2-carboxamide.
| Compound Name | N-[4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]-2-methoxyphenyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 54571447 |
| Molecular Formula | C25H19ClN4O4 |
| Molecular Weight | 474.90 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | N-[4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]-2-methoxyphenyl]quinoline-2-carboxamide |
| SMILES | COc1cc(C=NNC(=O)c2ccc(O)c(Cl)c2)ccc1NC(=O)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C25H19ClN4O4/c1-34-23-12-15(14-27-30-24(32)17-8-11-22(31)18(26)13-17)6-9-20(23)29-25(33)21-10-7-16-4-2-3-5-19(16)28-21/h2-14,31H,1H3,(H,29,33)(H,30,32) |
| InChIKey | ZXOCDBOVTSDTLC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.90 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|