C15H14ClN3O5S — CID 135582522
4-chloro-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-3-sulfamoylbenzamide (PubChem CID 135582522) has the molecular formula C15H14ClN3O5S and a molecular weight of 383.81 g/mol. Its IUPAC name is 4-chloro-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-3-sulfamoylbenzamide.
| Compound Name | 4-chloro-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 135582522 |
| Molecular Formula | C15H14ClN3O5S |
| Molecular Weight | 383.81 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | 4-chloro-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-3-sulfamoylbenzamide |
| SMILES | COc1cc(/C=N/NC(=O)c2ccc(Cl)c(S(N)(=O)=O)c2)ccc1O |
| InChI | InChI=1S/C15H14ClN3O5S/c1-24-13-6-9(2-5-12(13)20)8-18-19-15(21)10-3-4-11(16)14(7-10)25(17,22)23/h2-8,20H,1H3,(H,19,21)(H2,17,22,23)/b18-8+ |
| InChIKey | XNRDGORSBOVLNB-QGMBQPNBSA-N |
| XLogP | 1.47 |
| TPSA | 131.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.81 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|