C23H20ClN3O4 — CID 54009178
3-chloro-N-[[3,4-dimethoxy-5-(2-pyridin-2-ylethenyl)phenyl]methylideneamino]-4-hydroxybenzamide (PubChem CID 54009178) has the molecular formula C23H20ClN3O4 and a molecular weight of 437.88 g/mol. Its IUPAC name is 3-chloro-N-[[3,4-dimethoxy-5-(2-pyridin-2-ylethenyl)phenyl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-[[3,4-dimethoxy-5-(2-pyridin-2-ylethenyl)phenyl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 54009178 |
| Molecular Formula | C23H20ClN3O4 |
| Molecular Weight | 437.88 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 3-chloro-N-[[3,4-dimethoxy-5-(2-pyridin-2-ylethenyl)phenyl]methylideneamino]-4-hydroxybenzamide |
| SMILES | COc1cc(C=NNC(=O)c2ccc(O)c(Cl)c2)cc(C=Cc2ccccn2)c1OC |
| InChI | InChI=1S/C23H20ClN3O4/c1-30-21-12-15(14-26-27-23(29)17-7-9-20(28)19(24)13-17)11-16(22(21)31-2)6-8-18-5-3-4-10-25-18/h3-14,28H,1-2H3,(H,27,29) |
| InChIKey | KRBQQXIXFVUUIT-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.88 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|