C27H29ClN2O5 — CID 59092449
N-[(E)-[4-[(4-tert-butylphenyl)methoxy]-3,5-dimethoxyphenyl]methylideneamino]-3-chloro-4-hydroxybenzamide (PubChem CID 59092449) has the molecular formula C27H29ClN2O5 and a molecular weight of 496.99 g/mol. Its IUPAC name is N-[(E)-[4-[(4-tert-butylphenyl)methoxy]-3,5-dimethoxyphenyl]methylideneamino]-3-chloro-4-hydroxybenzamide.
| Compound Name | N-[(E)-[4-[(4-tert-butylphenyl)methoxy]-3,5-dimethoxyphenyl]methylideneamino]-3-chloro-4-hydroxybenzamide |
|---|---|
| PubChem CID | 59092449 |
| Molecular Formula | C27H29ClN2O5 |
| Molecular Weight | 496.99 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | N-[(E)-[4-[(4-tert-butylphenyl)methoxy]-3,5-dimethoxyphenyl]methylideneamino]-3-chloro-4-hydroxybenzamide |
| SMILES | COc1cc(/C=N/NC(=O)c2ccc(O)c(Cl)c2)cc(OC)c1OCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C27H29ClN2O5/c1-27(2,3)20-9-6-17(7-10-20)16-35-25-23(33-4)12-18(13-24(25)34-5)15-29-30-26(32)19-8-11-22(31)21(28)14-19/h6-15,31H,16H2,1-5H3,(H,30,32)/b29-15+ |
| InChIKey | GOFBHFPQERJAGS-WKULSOCRSA-N |
| XLogP | 5.70 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.99 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|