C26H23ClN2O7 — CID 59092103
5-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]-2-[(4-propan-2-ylphenyl)methoxy]benzene-1,3-dicarboxylic acid (PubChem CID 59092103) has the molecular formula C26H23ClN2O7 and a molecular weight of 510.93 g/mol. Its IUPAC name is 5-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]-2-[(4-propan-2-ylphenyl)methoxy]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]-2-[(4-propan-2-ylphenyl)methoxy]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 59092103 |
| Molecular Formula | C26H23ClN2O7 |
| Molecular Weight | 510.93 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | 5-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]-2-[(4-propan-2-ylphenyl)methoxy]benzene-1,3-dicarboxylic acid |
| SMILES | CC(C)c1ccc(COc2c(C(=O)O)cc(/C=N/NC(=O)c3ccc(O)c(Cl)c3)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C26H23ClN2O7/c1-14(2)17-5-3-15(4-6-17)13-36-23-19(25(32)33)9-16(10-20(23)26(34)35)12-28-29-24(31)18-7-8-22(30)21(27)11-18/h3-12,14,30H,13H2,1-2H3,(H,29,31)(H,32,33)(H,34,35)/b28-12+ |
| InChIKey | QNBAYUPOCXRMHM-KVSWJAHQSA-N |
| XLogP | 4.91 |
| TPSA | 145.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.93 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|