C27H23ClN2O3 — CID 59091617
3-chloro-4-hydroxy-N-[(E)-[4-(4-propan-2-ylphenoxy)naphthalen-1-yl]methylideneamino]benzamide (PubChem CID 59091617) has the molecular formula C27H23ClN2O3 and a molecular weight of 458.95 g/mol. Its IUPAC name is 3-chloro-4-hydroxy-N-[(E)-[4-(4-propan-2-ylphenoxy)naphthalen-1-yl]methylideneamino]benzamide.
| Compound Name | 3-chloro-4-hydroxy-N-[(E)-[4-(4-propan-2-ylphenoxy)naphthalen-1-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 59091617 |
| Molecular Formula | C27H23ClN2O3 |
| Molecular Weight | 458.95 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 3-chloro-4-hydroxy-N-[(E)-[4-(4-propan-2-ylphenoxy)naphthalen-1-yl]methylideneamino]benzamide |
| SMILES | CC(C)c1ccc(Oc2ccc(/C=N/NC(=O)c3ccc(O)c(Cl)c3)c3ccccc23)cc1 |
| InChI | InChI=1S/C27H23ClN2O3/c1-17(2)18-7-11-21(12-8-18)33-26-14-10-20(22-5-3-4-6-23(22)26)16-29-30-27(32)19-9-13-25(31)24(28)15-19/h3-17,31H,1-2H3,(H,30,32)/b29-16+ |
| InChIKey | SEAVSJXXGMQVTI-MUFRIFMGSA-N |
| XLogP | 6.88 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.95 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|