C32H26ClN3O4 — CID 59092413
3-chloro-4-hydroxy-N-[(E)-[4-[2-[[(1S)-1-naphthalen-2-ylethyl]amino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]benzamide (PubChem CID 59092413) has the molecular formula C32H26ClN3O4 and a molecular weight of 552.03 g/mol. Its IUPAC name is 3-chloro-4-hydroxy-N-[(E)-[4-[2-[[(1S)-1-naphthalen-2-ylethyl]amino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]benzamide.
| Compound Name | 3-chloro-4-hydroxy-N-[(E)-[4-[2-[[(1S)-1-naphthalen-2-ylethyl]amino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 59092413 |
| Molecular Formula | C32H26ClN3O4 |
| Molecular Weight | 552.03 g/mol |
| Exact Mass | 551.16 |
| IUPAC Name | 3-chloro-4-hydroxy-N-[(E)-[4-[2-[[(1S)-1-naphthalen-2-ylethyl]amino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]benzamide |
| SMILES | C[C@H](NC(=O)COc1ccc(/C=N/NC(=O)c2ccc(O)c(Cl)c2)c2ccccc12)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C32H26ClN3O4/c1-20(22-11-10-21-6-2-3-7-23(21)16-22)35-31(38)19-40-30-15-13-25(26-8-4-5-9-27(26)30)18-34-36-32(39)24-12-14-29(37)28(33)17-24/h2-18,20,37H,19H2,1H3,(H,35,38)(H,36,39)/b34-18+/t20-/m0/s1 |
| InChIKey | RRMWOAGJELFSEK-BWVZCWHBSA-N |
| XLogP | 6.37 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.03 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|