C28H23Cl2N3O4 — CID 59092370
3-chloro-N-[(E)-[4-[2-[1-(4-chlorophenyl)ethylamino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide (PubChem CID 59092370) has the molecular formula C28H23Cl2N3O4 and a molecular weight of 536.42 g/mol. Its IUPAC name is 3-chloro-N-[(E)-[4-[2-[1-(4-chlorophenyl)ethylamino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-[(E)-[4-[2-[1-(4-chlorophenyl)ethylamino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 59092370 |
| Molecular Formula | C28H23Cl2N3O4 |
| Molecular Weight | 536.42 g/mol |
| Exact Mass | 535.11 |
| IUPAC Name | 3-chloro-N-[(E)-[4-[2-[1-(4-chlorophenyl)ethylamino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
| SMILES | CC(NC(=O)COc1ccc(/C=N/NC(=O)c2ccc(O)c(Cl)c2)c2ccccc12)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H23Cl2N3O4/c1-17(18-6-10-21(29)11-7-18)32-27(35)16-37-26-13-9-20(22-4-2-3-5-23(22)26)15-31-33-28(36)19-8-12-25(34)24(30)14-19/h2-15,17,34H,16H2,1H3,(H,32,35)(H,33,36)/b31-15+ |
| InChIKey | UVTCSHGPJFNFHN-IBBHUPRXSA-N |
| XLogP | 5.87 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.42 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|