C33H25Cl2N3O5 — CID 59092586
3-chloro-N-[(E)-[4-[2-[(2-chloro-6-phenoxyphenyl)methylamino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide (PubChem CID 59092586) has the molecular formula C33H25Cl2N3O5 and a molecular weight of 614.49 g/mol. Its IUPAC name is 3-chloro-N-[(E)-[4-[2-[(2-chloro-6-phenoxyphenyl)methylamino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-[(E)-[4-[2-[(2-chloro-6-phenoxyphenyl)methylamino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 59092586 |
| Molecular Formula | C33H25Cl2N3O5 |
| Molecular Weight | 614.49 g/mol |
| Exact Mass | 613.12 |
| IUPAC Name | 3-chloro-N-[(E)-[4-[2-[(2-chloro-6-phenoxyphenyl)methylamino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
| SMILES | O=C(COc1ccc(/C=N/NC(=O)c2ccc(O)c(Cl)c2)c2ccccc12)NCc1c(Cl)cccc1Oc1ccccc1 |
| InChI | InChI=1S/C33H25Cl2N3O5/c34-27-11-6-12-31(43-23-7-2-1-3-8-23)26(27)19-36-32(40)20-42-30-16-14-22(24-9-4-5-10-25(24)30)18-37-38-33(41)21-13-15-29(39)28(35)17-21/h1-18,39H,19-20H2,(H,36,40)(H,38,41)/b37-18+ |
| InChIKey | AIVVMVIMVGKNMQ-RQRWGXNHSA-N |
| XLogP | 7.10 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.49 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|