C25H17Cl3N2O3 — CID 59092201
3-chloro-N-[(E)-[4-[(2,4-dichlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide (PubChem CID 59092201) has the molecular formula C25H17Cl3N2O3 and a molecular weight of 499.78 g/mol. Its IUPAC name is 3-chloro-N-[(E)-[4-[(2,4-dichlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-[(E)-[4-[(2,4-dichlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 59092201 |
| Molecular Formula | C25H17Cl3N2O3 |
| Molecular Weight | 499.78 g/mol |
| Exact Mass | 498.03 |
| IUPAC Name | 3-chloro-N-[(E)-[4-[(2,4-dichlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
| SMILES | O=C(N/N=C/c1ccc(OCc2ccc(Cl)cc2Cl)c2ccccc12)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C25H17Cl3N2O3/c26-18-8-5-17(21(27)12-18)14-33-24-10-7-16(19-3-1-2-4-20(19)24)13-29-30-25(32)15-6-9-23(31)22(28)11-15/h1-13,31H,14H2,(H,30,32)/b29-13+ |
| InChIKey | XHVBXRXWMXRJSA-VFLNYLIXSA-N |
| XLogP | 6.85 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.78 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|