C26H19ClF2N2O4 — CID 59091622
3-chloro-N-[(E)-[4-[[4-(difluoromethoxy)phenyl]methoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide (PubChem CID 59091622) has the molecular formula C26H19ClF2N2O4 and a molecular weight of 496.90 g/mol. Its IUPAC name is 3-chloro-N-[(E)-[4-[[4-(difluoromethoxy)phenyl]methoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-[(E)-[4-[[4-(difluoromethoxy)phenyl]methoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 59091622 |
| Molecular Formula | C26H19ClF2N2O4 |
| Molecular Weight | 496.90 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | 3-chloro-N-[(E)-[4-[[4-(difluoromethoxy)phenyl]methoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
| SMILES | O=C(N/N=C/c1ccc(OCc2ccc(OC(F)F)cc2)c2ccccc12)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C26H19ClF2N2O4/c27-22-13-17(7-11-23(22)32)25(33)31-30-14-18-8-12-24(21-4-2-1-3-20(18)21)34-15-16-5-9-19(10-6-16)35-26(28)29/h1-14,26,32H,15H2,(H,31,33)/b30-14+ |
| InChIKey | OWTQWVVGFXBDRQ-AMVVHIIESA-N |
| XLogP | 6.14 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.90 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|