C27H21ClN2O5 — CID 59092259
methyl 4-[[4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]naphthalen-1-yl]oxymethyl]benzoate (PubChem CID 59092259) has the molecular formula C27H21ClN2O5 and a molecular weight of 488.93 g/mol. Its IUPAC name is methyl 4-[[4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]naphthalen-1-yl]oxymethyl]benzoate.
| Compound Name | methyl 4-[[4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]naphthalen-1-yl]oxymethyl]benzoate |
|---|---|
| PubChem CID | 59092259 |
| Molecular Formula | C27H21ClN2O5 |
| Molecular Weight | 488.93 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | methyl 4-[[4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]naphthalen-1-yl]oxymethyl]benzoate |
| SMILES | COC(=O)c1ccc(COc2ccc(/C=N/NC(=O)c3ccc(O)c(Cl)c3)c3ccccc23)cc1 |
| InChI | InChI=1S/C27H21ClN2O5/c1-34-27(33)18-8-6-17(7-9-18)16-35-25-13-11-20(21-4-2-3-5-22(21)25)15-29-30-26(32)19-10-12-24(31)23(28)14-19/h2-15,31H,16H2,1H3,(H,30,32)/b29-15+ |
| InChIKey | KGAYNHAJZQOSEN-WKULSOCRSA-N |
| XLogP | 5.33 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.93 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|