C31H32ClN3O3 — CID 90785402
3-chloro-N-[(Z)-[4-[2-[2-(3,4-dimethylphenyl)ethyl-methylamino]ethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide (PubChem CID 90785402) has the molecular formula C31H32ClN3O3 and a molecular weight of 530.07 g/mol. Its IUPAC name is 3-chloro-N-[(Z)-[4-[2-[2-(3,4-dimethylphenyl)ethyl-methylamino]ethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-[(Z)-[4-[2-[2-(3,4-dimethylphenyl)ethyl-methylamino]ethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 90785402 |
| Molecular Formula | C31H32ClN3O3 |
| Molecular Weight | 530.07 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | 3-chloro-N-[(Z)-[4-[2-[2-(3,4-dimethylphenyl)ethyl-methylamino]ethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
| SMILES | Cc1ccc(CCN(C)CCOc2ccc(/C=N\NC(=O)c3ccc(O)c(Cl)c3)c3ccccc23)cc1C |
| InChI | InChI=1S/C31H32ClN3O3/c1-21-8-9-23(18-22(21)2)14-15-35(3)16-17-38-30-13-11-25(26-6-4-5-7-27(26)30)20-33-34-31(37)24-10-12-29(36)28(32)19-24/h4-13,18-20,36H,14-17H2,1-3H3,(H,34,37)/b33-20- |
| InChIKey | RWTWJAYBJVQPFG-UCMJSZAQSA-N |
| XLogP | 6.13 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.07 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|