C32H28ClF6N3O3 — CID 91495796
N-[(Z)-[4-[2-[[3,5-bis(trifluoromethyl)phenyl]methyl-propylamino]ethoxy]naphthalen-1-yl]methylideneamino]-3-chloro-4-hydroxybenzamide (PubChem CID 91495796) has the molecular formula C32H28ClF6N3O3 and a molecular weight of 652.04 g/mol. Its IUPAC name is N-[(Z)-[4-[2-[[3,5-bis(trifluoromethyl)phenyl]methyl-propylamino]ethoxy]naphthalen-1-yl]methylideneamino]-3-chloro-4-hydroxybenzamide.
| Compound Name | N-[(Z)-[4-[2-[[3,5-bis(trifluoromethyl)phenyl]methyl-propylamino]ethoxy]naphthalen-1-yl]methylideneamino]-3-chloro-4-hydroxybenzamide |
|---|---|
| PubChem CID | 91495796 |
| Molecular Formula | C32H28ClF6N3O3 |
| Molecular Weight | 652.04 g/mol |
| Exact Mass | 651.17 |
| IUPAC Name | N-[(Z)-[4-[2-[[3,5-bis(trifluoromethyl)phenyl]methyl-propylamino]ethoxy]naphthalen-1-yl]methylideneamino]-3-chloro-4-hydroxybenzamide |
| SMILES | CCCN(CCOc1ccc(/C=N\NC(=O)c2ccc(O)c(Cl)c2)c2ccccc12)Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C32H28ClF6N3O3/c1-2-11-42(19-20-14-23(31(34,35)36)17-24(15-20)32(37,38)39)12-13-45-29-10-8-22(25-5-3-4-6-26(25)29)18-40-41-30(44)21-7-9-28(43)27(33)16-21/h3-10,14-18,43H,2,11-13,19H2,1H3,(H,41,44)/b40-18- |
| InChIKey | XLOBFJYCMADQTG-POHGQRKGSA-N |
| XLogP | 8.29 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.04 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|