C31H30ClN4O6+ — CID 72514397
2-[benzyl-[2-[4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]naphthalen-1-yl]oxyacetyl]amino]ethyl-ethoxy-oxoazanium (PubChem CID 72514397) has the molecular formula C31H30ClN4O6+ and a molecular weight of 590.06 g/mol. Its IUPAC name is 2-[benzyl-[2-[4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]naphthalen-1-yl]oxyacetyl]amino]ethyl-ethoxy-oxoazanium.
| Compound Name | 2-[benzyl-[2-[4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]naphthalen-1-yl]oxyacetyl]amino]ethyl-ethoxy-oxoazanium |
|---|---|
| PubChem CID | 72514397 |
| Molecular Formula | C31H30ClN4O6+ |
| Molecular Weight | 590.06 g/mol |
| Exact Mass | 589.18 |
| IUPAC Name | 2-[benzyl-[2-[4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]naphthalen-1-yl]oxyacetyl]amino]ethyl-ethoxy-oxoazanium |
| SMILES | CCO[N+](=O)CCN(Cc1ccccc1)C(=O)COc1ccc(C=NNC(=O)c2ccc(O)c(Cl)c2)c2ccccc12 |
| InChI | InChI=1S/C31H29ClN4O6/c1-2-42-36(40)17-16-35(20-22-8-4-3-5-9-22)30(38)21-41-29-15-13-24(25-10-6-7-11-26(25)29)19-33-34-31(39)23-12-14-28(37)27(32)18-23/h3-15,18-19H,2,16-17,20-21H2,1H3,(H-,34,37,39)/p+1 |
| InChIKey | ISOWBLNUJFRBLA-UHFFFAOYSA-O |
| XLogP | 5.10 |
| TPSA | 120.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.06 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|