C23H19ClN4O4 — CID 59092583
3-chloro-N-[(E)-[4-[2-[cyanomethyl(methyl)amino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide (PubChem CID 59092583) has the molecular formula C23H19ClN4O4 and a molecular weight of 450.88 g/mol. Its IUPAC name is 3-chloro-N-[(E)-[4-[2-[cyanomethyl(methyl)amino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-[(E)-[4-[2-[cyanomethyl(methyl)amino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 59092583 |
| Molecular Formula | C23H19ClN4O4 |
| Molecular Weight | 450.88 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 3-chloro-N-[(E)-[4-[2-[cyanomethyl(methyl)amino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
| SMILES | CN(CC#N)C(=O)COc1ccc(/C=N/NC(=O)c2ccc(O)c(Cl)c2)c2ccccc12 |
| InChI | InChI=1S/C23H19ClN4O4/c1-28(11-10-25)22(30)14-32-21-9-7-16(17-4-2-3-5-18(17)21)13-26-27-23(31)15-6-8-20(29)19(24)12-15/h2-9,12-13,29H,11,14H2,1H3,(H,27,31)/b26-13+ |
| InChIKey | NNLXSFPAXBNFIP-LGJNPRDNSA-N |
| XLogP | 3.32 |
| TPSA | 115.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.88 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|