C26H29ClN4O4 — CID 72513815
3-chloro-N-[[4-[2-[2-(dimethylamino)ethyl-ethylamino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide (PubChem CID 72513815) has the molecular formula C26H29ClN4O4 and a molecular weight of 497.00 g/mol. Its IUPAC name is 3-chloro-N-[[4-[2-[2-(dimethylamino)ethyl-ethylamino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-[[4-[2-[2-(dimethylamino)ethyl-ethylamino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 72513815 |
| Molecular Formula | C26H29ClN4O4 |
| Molecular Weight | 497.00 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 3-chloro-N-[[4-[2-[2-(dimethylamino)ethyl-ethylamino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
| SMILES | CCN(CCN(C)C)C(=O)COc1ccc(C=NNC(=O)c2ccc(O)c(Cl)c2)c2ccccc12 |
| InChI | InChI=1S/C26H29ClN4O4/c1-4-31(14-13-30(2)3)25(33)17-35-24-12-10-19(20-7-5-6-8-21(20)24)16-28-29-26(34)18-9-11-23(32)22(27)15-18/h5-12,15-16,32H,4,13-14,17H2,1-3H3,(H,29,34) |
| InChIKey | GCNRWCFNVTZKME-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.00 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|