C29H34ClN5O4 — CID 59092089
3-chloro-N-[(E)-[4-[2-[4-[3-(dimethylamino)propyl]piperazin-1-yl]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide (PubChem CID 59092089) has the molecular formula C29H34ClN5O4 and a molecular weight of 552.08 g/mol. Its IUPAC name is 3-chloro-N-[(E)-[4-[2-[4-[3-(dimethylamino)propyl]piperazin-1-yl]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-[(E)-[4-[2-[4-[3-(dimethylamino)propyl]piperazin-1-yl]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 59092089 |
| Molecular Formula | C29H34ClN5O4 |
| Molecular Weight | 552.08 g/mol |
| Exact Mass | 551.23 |
| IUPAC Name | 3-chloro-N-[(E)-[4-[2-[4-[3-(dimethylamino)propyl]piperazin-1-yl]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
| SMILES | CN(C)CCCN1CCN(C(=O)COc2ccc(/C=N/NC(=O)c3ccc(O)c(Cl)c3)c3ccccc23)CC1 |
| InChI | InChI=1S/C29H34ClN5O4/c1-33(2)12-5-13-34-14-16-35(17-15-34)28(37)20-39-27-11-9-22(23-6-3-4-7-24(23)27)19-31-32-29(38)21-8-10-26(36)25(30)18-21/h3-4,6-11,18-19,36H,5,12-17,20H2,1-2H3,(H,32,38)/b31-19+ |
| InChIKey | WJPBHLQBPJGQMN-ZCTHSVRISA-N |
| XLogP | 3.44 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.08 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|