C32H29ClN4O6 — CID 59091666
N-[(E)-[4-[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-3-chloro-4-hydroxybenzamide (PubChem CID 59091666) has the molecular formula C32H29ClN4O6 and a molecular weight of 601.06 g/mol. Its IUPAC name is N-[(E)-[4-[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-3-chloro-4-hydroxybenzamide.
| Compound Name | N-[(E)-[4-[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-3-chloro-4-hydroxybenzamide |
|---|---|
| PubChem CID | 59091666 |
| Molecular Formula | C32H29ClN4O6 |
| Molecular Weight | 601.06 g/mol |
| Exact Mass | 600.18 |
| IUPAC Name | N-[(E)-[4-[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-3-chloro-4-hydroxybenzamide |
| SMILES | O=C(N/N=C/c1ccc(OCC(=O)N2CCN(Cc3ccc4c(c3)OCO4)CC2)c2ccccc12)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C32H29ClN4O6/c33-26-16-22(6-8-27(26)38)32(40)35-34-17-23-7-10-28(25-4-2-1-3-24(23)25)41-19-31(39)37-13-11-36(12-14-37)18-21-5-9-29-30(15-21)43-20-42-29/h1-10,15-17,38H,11-14,18-20H2,(H,35,40)/b34-17+ |
| InChIKey | XERZFVKOJXOEIH-KVAAJVFYSA-N |
| XLogP | 4.41 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.06 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|