C28H28ClN3O6 — CID 59091714
ethyl 1-[2-[4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]naphthalen-1-yl]oxyacetyl]piperidine-3-carboxylate (PubChem CID 59091714) has the molecular formula C28H28ClN3O6 and a molecular weight of 538.00 g/mol. Its IUPAC name is ethyl 1-[2-[4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]naphthalen-1-yl]oxyacetyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[2-[4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]naphthalen-1-yl]oxyacetyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 59091714 |
| Molecular Formula | C28H28ClN3O6 |
| Molecular Weight | 538.00 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | ethyl 1-[2-[4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]naphthalen-1-yl]oxyacetyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)COc2ccc(/C=N/NC(=O)c3ccc(O)c(Cl)c3)c3ccccc23)C1 |
| InChI | InChI=1S/C28H28ClN3O6/c1-2-37-28(36)20-6-5-13-32(16-20)26(34)17-38-25-12-10-19(21-7-3-4-8-22(21)25)15-30-31-27(35)18-9-11-24(33)23(29)14-18/h3-4,7-12,14-15,20,33H,2,5-6,13,16-17H2,1H3,(H,31,35)/b30-15+ |
| InChIKey | KWUCKSQPOGPSFM-FJEPWZHXSA-N |
| XLogP | 4.14 |
| TPSA | 117.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.00 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|