C26H26ClN3O5 — CID 22999377
1-[2-[4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]naphthalen-1-yl]oxyethyl]piperidine-4-carboxylic acid (PubChem CID 22999377) has the molecular formula C26H26ClN3O5 and a molecular weight of 495.96 g/mol. Its IUPAC name is 1-[2-[4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]naphthalen-1-yl]oxyethyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[2-[4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]naphthalen-1-yl]oxyethyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 22999377 |
| Molecular Formula | C26H26ClN3O5 |
| Molecular Weight | 495.96 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 1-[2-[4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]naphthalen-1-yl]oxyethyl]piperidine-4-carboxylic acid |
| SMILES | O=C(N/N=C/c1ccc(OCCN2CCC(C(=O)O)CC2)c2ccccc12)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C26H26ClN3O5/c27-22-15-18(5-7-23(22)31)25(32)29-28-16-19-6-8-24(21-4-2-1-3-20(19)21)35-14-13-30-11-9-17(10-12-30)26(33)34/h1-8,15-17,31H,9-14H2,(H,29,32)(H,33,34)/b28-16+ |
| InChIKey | USRZYFYWNKNXDB-LQKURTRISA-N |
| XLogP | 4.14 |
| TPSA | 111.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.96 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|