C30H28ClN3O4 — CID 72514630
3-chloro-N-[[4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]-8-methoxynaphthalen-1-yl]methylideneamino]-4-hydroxybenzamide (PubChem CID 72514630) has the molecular formula C30H28ClN3O4 and a molecular weight of 530.02 g/mol. Its IUPAC name is 3-chloro-N-[[4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]-8-methoxynaphthalen-1-yl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-[[4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]-8-methoxynaphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 72514630 |
| Molecular Formula | C30H28ClN3O4 |
| Molecular Weight | 530.02 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | 3-chloro-N-[[4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]-8-methoxynaphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
| SMILES | COc1cccc2c(OCCN3CCc4ccccc4C3)ccc(C=NNC(=O)c3ccc(O)c(Cl)c3)c12 |
| InChI | InChI=1S/C30H28ClN3O4/c1-37-28-8-4-7-24-27(38-16-15-34-14-13-20-5-2-3-6-23(20)19-34)12-10-22(29(24)28)18-32-33-30(36)21-9-11-26(35)25(31)17-21/h2-12,17-18,35H,13-16,19H2,1H3,(H,33,36) |
| InChIKey | FRRNPYXLJYUZDE-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.02 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|