C28H30ClN3O4 — CID 59092487
3-chloro-N-[(E)-[4-[4-(3,4-dihydro-1H-isoquinolin-2-yl)butoxy]-2-methoxyphenyl]methylideneamino]-4-hydroxybenzamide (PubChem CID 59092487) has the molecular formula C28H30ClN3O4 and a molecular weight of 508.02 g/mol. Its IUPAC name is 3-chloro-N-[(E)-[4-[4-(3,4-dihydro-1H-isoquinolin-2-yl)butoxy]-2-methoxyphenyl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-[(E)-[4-[4-(3,4-dihydro-1H-isoquinolin-2-yl)butoxy]-2-methoxyphenyl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 59092487 |
| Molecular Formula | C28H30ClN3O4 |
| Molecular Weight | 508.02 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | 3-chloro-N-[(E)-[4-[4-(3,4-dihydro-1H-isoquinolin-2-yl)butoxy]-2-methoxyphenyl]methylideneamino]-4-hydroxybenzamide |
| SMILES | COc1cc(OCCCCN2CCc3ccccc3C2)ccc1/C=N/NC(=O)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C28H30ClN3O4/c1-35-27-17-24(36-15-5-4-13-32-14-12-20-6-2-3-7-23(20)19-32)10-8-22(27)18-30-31-28(34)21-9-11-26(33)25(29)16-21/h2-3,6-11,16-18,33H,4-5,12-15,19H2,1H3,(H,31,34)/b30-18+ |
| InChIKey | TVKKKHFRRHDDBW-UXHLAJHPSA-N |
| XLogP | 5.04 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.02 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|