C29H37ClN4O3 — CID 172922907
3-chloro-4-hydroxy-N-[(E)-[2-methyl-4-[2-[4-(3-methylphenyl)piperazin-1-yl]ethoxy]phenyl]methylideneamino]benzamide;methane;molecular hydrogen (PubChem CID 172922907) has the molecular formula C29H37ClN4O3 and a molecular weight of 525.09 g/mol. Its IUPAC name is 3-chloro-4-hydroxy-N-[(E)-[2-methyl-4-[2-[4-(3-methylphenyl)piperazin-1-yl]ethoxy]phenyl]methylideneamino]benzamide;methane;molecular hydrogen.
| Compound Name | 3-chloro-4-hydroxy-N-[(E)-[2-methyl-4-[2-[4-(3-methylphenyl)piperazin-1-yl]ethoxy]phenyl]methylideneamino]benzamide;methane;molecular hydrogen |
|---|---|
| PubChem CID | 172922907 |
| Molecular Formula | C29H37ClN4O3 |
| Molecular Weight | 525.09 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | 3-chloro-4-hydroxy-N-[(E)-[2-methyl-4-[2-[4-(3-methylphenyl)piperazin-1-yl]ethoxy]phenyl]methylideneamino]benzamide;methane;molecular hydrogen |
| SMILES | C.Cc1cccc(N2CCN(CCOc3ccc(/C=N/NC(=O)c4ccc(O)c(Cl)c4)c(C)c3)CC2)c1.[H][H] |
| InChI | InChI=1S/C28H31ClN4O3.CH4.H2/c1-20-4-3-5-24(16-20)33-12-10-32(11-13-33)14-15-36-25-8-6-23(21(2)17-25)19-30-31-28(35)22-7-9-27(34)26(29)18-22;;/h3-9,16-19,34H,10-15H2,1-2H3,(H,31,35);1H4;1H/b30-19+;; |
| InChIKey | MGALOXMMYZLKCK-IKXMTGLRSA-N |
| XLogP | 5.51 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.09 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|