C26H30ClN5O2 — CID 59092492
3-chloro-N-[(E)-[2,3-dimethyl-4-[4-(2-pyrrol-1-ylethyl)piperazin-1-yl]phenyl]methylideneamino]-4-hydroxybenzamide (PubChem CID 59092492) has the molecular formula C26H30ClN5O2 and a molecular weight of 480.01 g/mol. Its IUPAC name is 3-chloro-N-[(E)-[2,3-dimethyl-4-[4-(2-pyrrol-1-ylethyl)piperazin-1-yl]phenyl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-[(E)-[2,3-dimethyl-4-[4-(2-pyrrol-1-ylethyl)piperazin-1-yl]phenyl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 59092492 |
| Molecular Formula | C26H30ClN5O2 |
| Molecular Weight | 480.01 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | 3-chloro-N-[(E)-[2,3-dimethyl-4-[4-(2-pyrrol-1-ylethyl)piperazin-1-yl]phenyl]methylideneamino]-4-hydroxybenzamide |
| SMILES | Cc1c(/C=N/NC(=O)c2ccc(O)c(Cl)c2)ccc(N2CCN(CCn3cccc3)CC2)c1C |
| InChI | InChI=1S/C26H30ClN5O2/c1-19-20(2)24(32-15-13-31(14-16-32)12-11-30-9-3-4-10-30)7-5-22(19)18-28-29-26(34)21-6-8-25(33)23(27)17-21/h3-10,17-18,33H,11-16H2,1-2H3,(H,29,34)/b28-18+ |
| InChIKey | GDWXCGLUYUYTSP-MTDXEUNCSA-N |
| XLogP | 4.05 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.01 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|