C27H21ClN2O2 — CID 72513914
3-chloro-4-hydroxy-N-[[4-(3-phenylprop-1-enyl)naphthalen-1-yl]methylideneamino]benzamide (PubChem CID 72513914) has the molecular formula C27H21ClN2O2 and a molecular weight of 440.93 g/mol. Its IUPAC name is 3-chloro-4-hydroxy-N-[[4-(3-phenylprop-1-enyl)naphthalen-1-yl]methylideneamino]benzamide.
| Compound Name | 3-chloro-4-hydroxy-N-[[4-(3-phenylprop-1-enyl)naphthalen-1-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 72513914 |
| Molecular Formula | C27H21ClN2O2 |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 3-chloro-4-hydroxy-N-[[4-(3-phenylprop-1-enyl)naphthalen-1-yl]methylideneamino]benzamide |
| SMILES | O=C(NN=Cc1ccc(C=CCc2ccccc2)c2ccccc12)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C27H21ClN2O2/c28-25-17-21(15-16-26(25)31)27(32)30-29-18-22-14-13-20(23-11-4-5-12-24(22)23)10-6-9-19-7-2-1-3-8-19/h1-8,10-18,31H,9H2,(H,30,32) |
| InChIKey | CSJMGSKQNBIORQ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|