C23H17ClN2O4 — CID 72514485
5-[4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]naphthalen-1-yl]pent-4-ynoic acid (PubChem CID 72514485) has the molecular formula C23H17ClN2O4 and a molecular weight of 420.85 g/mol. Its IUPAC name is 5-[4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]naphthalen-1-yl]pent-4-ynoic acid.
| Compound Name | 5-[4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]naphthalen-1-yl]pent-4-ynoic acid |
|---|---|
| PubChem CID | 72514485 |
| Molecular Formula | C23H17ClN2O4 |
| Molecular Weight | 420.85 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 5-[4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]naphthalen-1-yl]pent-4-ynoic acid |
| SMILES | O=C(O)CCC#Cc1ccc(C=NNC(=O)c2ccc(O)c(Cl)c2)c2ccccc12 |
| InChI | InChI=1S/C23H17ClN2O4/c24-20-13-16(11-12-21(20)27)23(30)26-25-14-17-10-9-15(5-1-4-8-22(28)29)18-6-2-3-7-19(17)18/h2-3,6-7,9-14,27H,4,8H2,(H,26,30)(H,28,29) |
| InChIKey | UUCJDYQTXAFDOG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.85 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|