C19H13ClN2O4 — CID 67483815
4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]naphthalene-1-carboxylic acid (PubChem CID 67483815) has the molecular formula C19H13ClN2O4 and a molecular weight of 368.78 g/mol. Its IUPAC name is 4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]naphthalene-1-carboxylic acid.
| Compound Name | 4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 67483815 |
| Molecular Formula | C19H13ClN2O4 |
| Molecular Weight | 368.78 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]naphthalene-1-carboxylic acid |
| SMILES | O=C(NN=Cc1ccc(C(=O)O)c2ccccc12)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C19H13ClN2O4/c20-16-9-11(6-8-17(16)23)18(24)22-21-10-12-5-7-15(19(25)26)14-4-2-1-3-13(12)14/h1-10,23H,(H,22,24)(H,25,26) |
| InChIKey | BIIZOTYJUYIRQE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.78 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|