C28H24ClN3O4 — CID 59091707
4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]-N-(2-hydroxy-2-phenylethyl)-N-methylnaphthalene-1-carboxamide (PubChem CID 59091707) has the molecular formula C28H24ClN3O4 and a molecular weight of 501.97 g/mol. Its IUPAC name is 4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]-N-(2-hydroxy-2-phenylethyl)-N-methylnaphthalene-1-carboxamide.
| Compound Name | 4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]-N-(2-hydroxy-2-phenylethyl)-N-methylnaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 59091707 |
| Molecular Formula | C28H24ClN3O4 |
| Molecular Weight | 501.97 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | 4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]-N-(2-hydroxy-2-phenylethyl)-N-methylnaphthalene-1-carboxamide |
| SMILES | CN(CC(O)c1ccccc1)C(=O)c1ccc(/C=N/NC(=O)c2ccc(O)c(Cl)c2)c2ccccc12 |
| InChI | InChI=1S/C28H24ClN3O4/c1-32(17-26(34)18-7-3-2-4-8-18)28(36)23-13-11-20(21-9-5-6-10-22(21)23)16-30-31-27(35)19-12-14-25(33)24(29)15-19/h2-16,26,33-34H,17H2,1H3,(H,31,35)/b30-16+ |
| InChIKey | RCFKKDMHFLCNDN-OKCVXOCRSA-N |
| XLogP | 4.77 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.97 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|