C27H21ClFN3O3 — CID 72513793
4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]-N-[2-(4-fluorophenyl)ethyl]naphthalene-1-carboxamide (PubChem CID 72513793) has the molecular formula C27H21ClFN3O3 and a molecular weight of 489.93 g/mol. Its IUPAC name is 4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]-N-[2-(4-fluorophenyl)ethyl]naphthalene-1-carboxamide.
| Compound Name | 4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]-N-[2-(4-fluorophenyl)ethyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 72513793 |
| Molecular Formula | C27H21ClFN3O3 |
| Molecular Weight | 489.93 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | 4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]-N-[2-(4-fluorophenyl)ethyl]naphthalene-1-carboxamide |
| SMILES | O=C(NN=Cc1ccc(C(=O)NCCc2ccc(F)cc2)c2ccccc12)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C27H21ClFN3O3/c28-24-15-18(8-12-25(24)33)26(34)32-31-16-19-7-11-23(22-4-2-1-3-21(19)22)27(35)30-14-13-17-5-9-20(29)10-6-17/h1-12,15-16,33H,13-14H2,(H,30,35)(H,32,34) |
| InChIKey | CIDMRYKEUOKCJW-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.93 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|