C29H26ClN3O4 — CID 59092582
4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]-N-[2-(2-ethoxyphenyl)ethyl]naphthalene-1-carboxamide (PubChem CID 59092582) has the molecular formula C29H26ClN3O4 and a molecular weight of 516.00 g/mol. Its IUPAC name is 4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]-N-[2-(2-ethoxyphenyl)ethyl]naphthalene-1-carboxamide.
| Compound Name | 4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]-N-[2-(2-ethoxyphenyl)ethyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 59092582 |
| Molecular Formula | C29H26ClN3O4 |
| Molecular Weight | 516.00 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | 4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]-N-[2-(2-ethoxyphenyl)ethyl]naphthalene-1-carboxamide |
| SMILES | CCOc1ccccc1CCNC(=O)c1ccc(/C=N/NC(=O)c2ccc(O)c(Cl)c2)c2ccccc12 |
| InChI | InChI=1S/C29H26ClN3O4/c1-2-37-27-10-6-3-7-19(27)15-16-31-29(36)24-13-11-21(22-8-4-5-9-23(22)24)18-32-33-28(35)20-12-14-26(34)25(30)17-20/h3-14,17-18,34H,2,15-16H2,1H3,(H,31,36)(H,33,35)/b32-18+ |
| InChIKey | ARIJWDYSRMDVTD-KCSSXMTESA-N |
| XLogP | 5.33 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.00 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|