C28H21ClF3N3O3 — CID 72513905
4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]-N-[2-[3-(trifluoromethyl)phenyl]ethyl]naphthalene-1-carboxamide (PubChem CID 72513905) has the molecular formula C28H21ClF3N3O3 and a molecular weight of 539.94 g/mol. Its IUPAC name is 4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]-N-[2-[3-(trifluoromethyl)phenyl]ethyl]naphthalene-1-carboxamide.
| Compound Name | 4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]-N-[2-[3-(trifluoromethyl)phenyl]ethyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 72513905 |
| Molecular Formula | C28H21ClF3N3O3 |
| Molecular Weight | 539.94 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | 4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]-N-[2-[3-(trifluoromethyl)phenyl]ethyl]naphthalene-1-carboxamide |
| SMILES | O=C(NN=Cc1ccc(C(=O)NCCc2cccc(C(F)(F)F)c2)c2ccccc12)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C28H21ClF3N3O3/c29-24-15-18(9-11-25(24)36)26(37)35-34-16-19-8-10-23(22-7-2-1-6-21(19)22)27(38)33-13-12-17-4-3-5-20(14-17)28(30,31)32/h1-11,14-16,36H,12-13H2,(H,33,38)(H,35,37) |
| InChIKey | WGPOIBQCTDJECG-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.94 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|