C27H18ClF4N3O3 — CID 72514528
4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]-N-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]naphthalene-1-carboxamide (PubChem CID 72514528) has the molecular formula C27H18ClF4N3O3 and a molecular weight of 543.90 g/mol. Its IUPAC name is 4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]-N-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]naphthalene-1-carboxamide.
| Compound Name | 4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]-N-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 72514528 |
| Molecular Formula | C27H18ClF4N3O3 |
| Molecular Weight | 543.90 g/mol |
| Exact Mass | 543.10 |
| IUPAC Name | 4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]-N-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]naphthalene-1-carboxamide |
| SMILES | O=C(NN=Cc1ccc(C(=O)NCc2ccc(F)c(C(F)(F)F)c2)c2ccccc12)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C27H18ClF4N3O3/c28-22-12-16(7-10-24(22)36)25(37)35-34-14-17-6-8-20(19-4-2-1-3-18(17)19)26(38)33-13-15-5-9-23(29)21(11-15)27(30,31)32/h1-12,14,36H,13H2,(H,33,38)(H,35,37) |
| InChIKey | RDDZMMYJLXWCSQ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.90 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|