C25H18ClFN2O3 — CID 59091778
3-chloro-N-[(E)-[4-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide (PubChem CID 59091778) has the molecular formula C25H18ClFN2O3 and a molecular weight of 448.88 g/mol. Its IUPAC name is 3-chloro-N-[(E)-[4-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-[(E)-[4-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 59091778 |
| Molecular Formula | C25H18ClFN2O3 |
| Molecular Weight | 448.88 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 3-chloro-N-[(E)-[4-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
| SMILES | O=C(N/N=C/c1ccc(OCc2ccc(F)cc2)c2ccccc12)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C25H18ClFN2O3/c26-22-13-17(7-11-23(22)30)25(31)29-28-14-18-8-12-24(21-4-2-1-3-20(18)21)32-15-16-5-9-19(27)10-6-16/h1-14,30H,15H2,(H,29,31)/b28-14+ |
| InChIKey | OWVQFSVNGKBWDX-CCVNUDIWSA-N |
| XLogP | 5.68 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.88 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|