C27H18ClN3O5 — CID 54032833
3-chloro-N-[[4-[(1,3-dioxoisoindol-2-yl)methoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide (PubChem CID 54032833) has the molecular formula C27H18ClN3O5 and a molecular weight of 499.91 g/mol. Its IUPAC name is 3-chloro-N-[[4-[(1,3-dioxoisoindol-2-yl)methoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-[[4-[(1,3-dioxoisoindol-2-yl)methoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 54032833 |
| Molecular Formula | C27H18ClN3O5 |
| Molecular Weight | 499.91 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | 3-chloro-N-[[4-[(1,3-dioxoisoindol-2-yl)methoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
| SMILES | O=C(NN=Cc1ccc(OCN2C(=O)c3ccccc3C2=O)c2ccccc12)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C27H18ClN3O5/c28-22-13-16(9-11-23(22)32)25(33)30-29-14-17-10-12-24(19-6-2-1-5-18(17)19)36-15-31-26(34)20-7-3-4-8-21(20)27(31)35/h1-14,32H,15H2,(H,30,33) |
| InChIKey | LGVBZIQJUFJCCI-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.91 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|