C28H24ClFN4O3 — CID 72514117
3-chloro-N-[[4-[2-[2-(4-fluoroanilino)ethylamino]-2-oxoethyl]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide (PubChem CID 72514117) has the molecular formula C28H24ClFN4O3 and a molecular weight of 518.98 g/mol. Its IUPAC name is 3-chloro-N-[[4-[2-[2-(4-fluoroanilino)ethylamino]-2-oxoethyl]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-[[4-[2-[2-(4-fluoroanilino)ethylamino]-2-oxoethyl]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 72514117 |
| Molecular Formula | C28H24ClFN4O3 |
| Molecular Weight | 518.98 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | 3-chloro-N-[[4-[2-[2-(4-fluoroanilino)ethylamino]-2-oxoethyl]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
| SMILES | O=C(Cc1ccc(C=NNC(=O)c2ccc(O)c(Cl)c2)c2ccccc12)NCCNc1ccc(F)cc1 |
| InChI | InChI=1S/C28H24ClFN4O3/c29-25-15-19(7-12-26(25)35)28(37)34-33-17-20-6-5-18(23-3-1-2-4-24(20)23)16-27(36)32-14-13-31-22-10-8-21(30)9-11-22/h1-12,15,17,31,35H,13-14,16H2,(H,32,36)(H,34,37) |
| InChIKey | SNKYCWZDFOWTMV-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.98 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|