C30H29ClN4O3 — CID 72513893
3-chloro-4-hydroxy-N-[[4-[2-[3-(N-methylanilino)propylamino]-2-oxoethyl]naphthalen-1-yl]methylideneamino]benzamide (PubChem CID 72513893) has the molecular formula C30H29ClN4O3 and a molecular weight of 529.04 g/mol. Its IUPAC name is 3-chloro-4-hydroxy-N-[[4-[2-[3-(N-methylanilino)propylamino]-2-oxoethyl]naphthalen-1-yl]methylideneamino]benzamide.
| Compound Name | 3-chloro-4-hydroxy-N-[[4-[2-[3-(N-methylanilino)propylamino]-2-oxoethyl]naphthalen-1-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 72513893 |
| Molecular Formula | C30H29ClN4O3 |
| Molecular Weight | 529.04 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | 3-chloro-4-hydroxy-N-[[4-[2-[3-(N-methylanilino)propylamino]-2-oxoethyl]naphthalen-1-yl]methylideneamino]benzamide |
| SMILES | CN(CCCNC(=O)Cc1ccc(C=NNC(=O)c2ccc(O)c(Cl)c2)c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C30H29ClN4O3/c1-35(24-8-3-2-4-9-24)17-7-16-32-29(37)19-21-12-13-23(26-11-6-5-10-25(21)26)20-33-34-30(38)22-14-15-28(36)27(31)18-22/h2-6,8-15,18,20,36H,7,16-17,19H2,1H3,(H,32,37)(H,34,38) |
| InChIKey | RBEZZEHQNBJERW-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.04 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|