C28H22Cl3N3O3 — CID 72514298
3-chloro-N-[[4-[2-[2-(2,6-dichlorophenyl)ethylamino]-2-oxoethyl]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide (PubChem CID 72514298) has the molecular formula C28H22Cl3N3O3 and a molecular weight of 554.86 g/mol. Its IUPAC name is 3-chloro-N-[[4-[2-[2-(2,6-dichlorophenyl)ethylamino]-2-oxoethyl]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-[[4-[2-[2-(2,6-dichlorophenyl)ethylamino]-2-oxoethyl]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 72514298 |
| Molecular Formula | C28H22Cl3N3O3 |
| Molecular Weight | 554.86 g/mol |
| Exact Mass | 553.07 |
| IUPAC Name | 3-chloro-N-[[4-[2-[2-(2,6-dichlorophenyl)ethylamino]-2-oxoethyl]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
| SMILES | O=C(Cc1ccc(C=NNC(=O)c2ccc(O)c(Cl)c2)c2ccccc12)NCCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C28H22Cl3N3O3/c29-23-6-3-7-24(30)22(23)12-13-32-27(36)15-17-8-9-19(21-5-2-1-4-20(17)21)16-33-34-28(37)18-10-11-26(35)25(31)14-18/h1-11,14,16,35H,12-13,15H2,(H,32,36)(H,34,37) |
| InChIKey | MTVDFJPTUXSIOO-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.86 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|