C29H24Cl2FN3O4S — CID 59092183
3-chloro-N-[(E)-[4-[2-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethylamino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide (PubChem CID 59092183) has the molecular formula C29H24Cl2FN3O4S and a molecular weight of 600.50 g/mol. Its IUPAC name is 3-chloro-N-[(E)-[4-[2-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethylamino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-[(E)-[4-[2-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethylamino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 59092183 |
| Molecular Formula | C29H24Cl2FN3O4S |
| Molecular Weight | 600.50 g/mol |
| Exact Mass | 599.08 |
| IUPAC Name | 3-chloro-N-[(E)-[4-[2-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethylamino]-2-oxoethoxy]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
| SMILES | O=C(COc1ccc(/C=N/NC(=O)c2ccc(O)c(Cl)c2)c2ccccc12)NCCSCc1c(F)cccc1Cl |
| InChI | InChI=1S/C29H24Cl2FN3O4S/c30-23-6-3-7-25(32)22(23)17-40-13-12-33-28(37)16-39-27-11-9-19(20-4-1-2-5-21(20)27)15-34-35-29(38)18-8-10-26(36)24(31)14-18/h1-11,14-15,36H,12-13,16-17H2,(H,33,37)(H,35,38)/b34-15+ |
| InChIKey | IIBYBWXBMKBQRR-PUHLOBNQSA-N |
| XLogP | 6.18 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.50 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|