C27H23Cl2N3O2 — CID 72514241
3-chloro-N-[[4-[[1-(4-chlorophenyl)ethylamino]methyl]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide (PubChem CID 72514241) has the molecular formula C27H23Cl2N3O2 and a molecular weight of 492.41 g/mol. Its IUPAC name is 3-chloro-N-[[4-[[1-(4-chlorophenyl)ethylamino]methyl]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-[[4-[[1-(4-chlorophenyl)ethylamino]methyl]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 72514241 |
| Molecular Formula | C27H23Cl2N3O2 |
| Molecular Weight | 492.41 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | 3-chloro-N-[[4-[[1-(4-chlorophenyl)ethylamino]methyl]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
| SMILES | CC(NCc1ccc(C=NNC(=O)c2ccc(O)c(Cl)c2)c2ccccc12)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H23Cl2N3O2/c1-17(18-8-11-22(28)12-9-18)30-15-20-6-7-21(24-5-3-2-4-23(20)24)16-31-32-27(34)19-10-13-26(33)25(29)14-19/h2-14,16-17,30,33H,15H2,1H3,(H,32,34) |
| InChIKey | WRSXUWLYDUWINN-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.41 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|