C25H22ClN3O3 — CID 72514151
3-chloro-4-hydroxy-N-[[4-[[(5-methylfuran-2-yl)methylamino]methyl]naphthalen-1-yl]methylideneamino]benzamide (PubChem CID 72514151) has the molecular formula C25H22ClN3O3 and a molecular weight of 447.92 g/mol. Its IUPAC name is 3-chloro-4-hydroxy-N-[[4-[[(5-methylfuran-2-yl)methylamino]methyl]naphthalen-1-yl]methylideneamino]benzamide.
| Compound Name | 3-chloro-4-hydroxy-N-[[4-[[(5-methylfuran-2-yl)methylamino]methyl]naphthalen-1-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 72514151 |
| Molecular Formula | C25H22ClN3O3 |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 3-chloro-4-hydroxy-N-[[4-[[(5-methylfuran-2-yl)methylamino]methyl]naphthalen-1-yl]methylideneamino]benzamide |
| SMILES | Cc1ccc(CNCc2ccc(C=NNC(=O)c3ccc(O)c(Cl)c3)c3ccccc23)o1 |
| InChI | InChI=1S/C25H22ClN3O3/c1-16-6-10-20(32-16)15-27-13-18-7-8-19(22-5-3-2-4-21(18)22)14-28-29-25(31)17-9-11-24(30)23(26)12-17/h2-12,14,27,30H,13,15H2,1H3,(H,29,31) |
| InChIKey | GQNUMCNKPIKWPD-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|