C25H24ClN3O3 — CID 72514360
3-chloro-N-[[4-[3-(diethylamino)-3-oxoprop-1-enyl]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide (PubChem CID 72514360) has the molecular formula C25H24ClN3O3 and a molecular weight of 449.94 g/mol. Its IUPAC name is 3-chloro-N-[[4-[3-(diethylamino)-3-oxoprop-1-enyl]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-[[4-[3-(diethylamino)-3-oxoprop-1-enyl]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 72514360 |
| Molecular Formula | C25H24ClN3O3 |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 3-chloro-N-[[4-[3-(diethylamino)-3-oxoprop-1-enyl]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
| SMILES | CCN(CC)C(=O)C=Cc1ccc(C=NNC(=O)c2ccc(O)c(Cl)c2)c2ccccc12 |
| InChI | InChI=1S/C25H24ClN3O3/c1-3-29(4-2)24(31)14-12-17-9-10-19(21-8-6-5-7-20(17)21)16-27-28-25(32)18-11-13-23(30)22(26)15-18/h5-16,30H,3-4H2,1-2H3,(H,28,32) |
| InChIKey | SAHIFHGHNNIJLM-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|