C26H26ClN3O2 — CID 54074918
N-[[4-[2-(1-aminocyclohexyl)ethenyl]naphthalen-1-yl]methylideneamino]-3-chloro-4-hydroxybenzamide (PubChem CID 54074918) has the molecular formula C26H26ClN3O2 and a molecular weight of 447.97 g/mol. Its IUPAC name is N-[[4-[2-(1-aminocyclohexyl)ethenyl]naphthalen-1-yl]methylideneamino]-3-chloro-4-hydroxybenzamide.
| Compound Name | N-[[4-[2-(1-aminocyclohexyl)ethenyl]naphthalen-1-yl]methylideneamino]-3-chloro-4-hydroxybenzamide |
|---|---|
| PubChem CID | 54074918 |
| Molecular Formula | C26H26ClN3O2 |
| Molecular Weight | 447.97 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | N-[[4-[2-(1-aminocyclohexyl)ethenyl]naphthalen-1-yl]methylideneamino]-3-chloro-4-hydroxybenzamide |
| SMILES | NC1(C=Cc2ccc(C=NNC(=O)c3ccc(O)c(Cl)c3)c3ccccc23)CCCCC1 |
| InChI | InChI=1S/C26H26ClN3O2/c27-23-16-19(10-11-24(23)31)25(32)30-29-17-20-9-8-18(21-6-2-3-7-22(20)21)12-15-26(28)13-4-1-5-14-26/h2-3,6-12,15-17,31H,1,4-5,13-14,28H2,(H,30,32) |
| InChIKey | MIZXGDUUYWZBMT-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.97 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|