C24H28ClN3O4 — CID 59091872
N-[(E)-[3-[(E)-2-(1-aminocyclohexyl)ethenyl]-4,5-dimethoxyphenyl]methylideneamino]-3-chloro-4-hydroxybenzamide (PubChem CID 59091872) has the molecular formula C24H28ClN3O4 and a molecular weight of 457.96 g/mol. Its IUPAC name is N-[(E)-[3-[(E)-2-(1-aminocyclohexyl)ethenyl]-4,5-dimethoxyphenyl]methylideneamino]-3-chloro-4-hydroxybenzamide.
| Compound Name | N-[(E)-[3-[(E)-2-(1-aminocyclohexyl)ethenyl]-4,5-dimethoxyphenyl]methylideneamino]-3-chloro-4-hydroxybenzamide |
|---|---|
| PubChem CID | 59091872 |
| Molecular Formula | C24H28ClN3O4 |
| Molecular Weight | 457.96 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | N-[(E)-[3-[(E)-2-(1-aminocyclohexyl)ethenyl]-4,5-dimethoxyphenyl]methylideneamino]-3-chloro-4-hydroxybenzamide |
| SMILES | COc1cc(/C=N/NC(=O)c2ccc(O)c(Cl)c2)cc(/C=C/C2(N)CCCCC2)c1OC |
| InChI | InChI=1S/C24H28ClN3O4/c1-31-21-13-16(15-27-28-23(30)18-6-7-20(29)19(25)14-18)12-17(22(21)32-2)8-11-24(26)9-4-3-5-10-24/h6-8,11-15,29H,3-5,9-10,26H2,1-2H3,(H,28,30)/b11-8+,27-15+ |
| InChIKey | ACEUWRMSAUBLLA-UEIKBURBSA-N |
| XLogP | 4.50 |
| TPSA | 106.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.96 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|