C25H19Cl3N2O5 — CID 72514524
3-chloro-N-[[3-[3-(2,6-dichlorophenoxy)prop-1-ynyl]-4,5-dimethoxyphenyl]methylideneamino]-4-hydroxybenzamide (PubChem CID 72514524) has the molecular formula C25H19Cl3N2O5 and a molecular weight of 533.80 g/mol. Its IUPAC name is 3-chloro-N-[[3-[3-(2,6-dichlorophenoxy)prop-1-ynyl]-4,5-dimethoxyphenyl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-[[3-[3-(2,6-dichlorophenoxy)prop-1-ynyl]-4,5-dimethoxyphenyl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 72514524 |
| Molecular Formula | C25H19Cl3N2O5 |
| Molecular Weight | 533.80 g/mol |
| Exact Mass | 532.04 |
| IUPAC Name | 3-chloro-N-[[3-[3-(2,6-dichlorophenoxy)prop-1-ynyl]-4,5-dimethoxyphenyl]methylideneamino]-4-hydroxybenzamide |
| SMILES | COc1cc(C=NNC(=O)c2ccc(O)c(Cl)c2)cc(C#CCOc2c(Cl)cccc2Cl)c1OC |
| InChI | InChI=1S/C25H19Cl3N2O5/c1-33-22-12-15(14-29-30-25(32)17-8-9-21(31)20(28)13-17)11-16(23(22)34-2)5-4-10-35-24-18(26)6-3-7-19(24)27/h3,6-9,11-14,31H,10H2,1-2H3,(H,30,32) |
| InChIKey | BJAGTWAIOWLVOH-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.80 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|