C26H26ClN3O4 — CID 67483232
[4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]naphthalen-1-yl]methyl N-cyclohexylcarbamate (PubChem CID 67483232) has the molecular formula C26H26ClN3O4 and a molecular weight of 479.96 g/mol. Its IUPAC name is [4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]naphthalen-1-yl]methyl N-cyclohexylcarbamate.
| Compound Name | [4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]naphthalen-1-yl]methyl N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 67483232 |
| Molecular Formula | C26H26ClN3O4 |
| Molecular Weight | 479.96 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | [4-[[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]naphthalen-1-yl]methyl N-cyclohexylcarbamate |
| SMILES | O=C(NC1CCCCC1)OCc1ccc(C=NNC(=O)c2ccc(O)c(Cl)c2)c2ccccc12 |
| InChI | InChI=1S/C26H26ClN3O4/c27-23-14-17(12-13-24(23)31)25(32)30-28-15-18-10-11-19(22-9-5-4-8-21(18)22)16-34-26(33)29-20-6-2-1-3-7-20/h4-5,8-15,20,31H,1-3,6-7,16H2,(H,29,33)(H,30,32) |
| InChIKey | MIAUVSWXALWLTK-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.96 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|