C31H34ClN3O3 — CID 59091755
4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]-N-(2-cyclohexylcyclohexyl)naphthalene-1-carboxamide (PubChem CID 59091755) has the molecular formula C31H34ClN3O3 and a molecular weight of 532.08 g/mol. Its IUPAC name is 4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]-N-(2-cyclohexylcyclohexyl)naphthalene-1-carboxamide.
| Compound Name | 4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]-N-(2-cyclohexylcyclohexyl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 59091755 |
| Molecular Formula | C31H34ClN3O3 |
| Molecular Weight | 532.08 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | 4-[(E)-[(3-chloro-4-hydroxybenzoyl)hydrazinylidene]methyl]-N-(2-cyclohexylcyclohexyl)naphthalene-1-carboxamide |
| SMILES | O=C(N/N=C/c1ccc(C(=O)NC2CCCCC2C2CCCCC2)c2ccccc12)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C31H34ClN3O3/c32-27-18-21(15-17-29(27)36)30(37)35-33-19-22-14-16-26(25-12-5-4-10-23(22)25)31(38)34-28-13-7-6-11-24(28)20-8-2-1-3-9-20/h4-5,10,12,14-20,24,28,36H,1-3,6-9,11,13H2,(H,34,38)(H,35,37)/b33-19+ |
| InChIKey | MNWBDMLEGJAQRX-HNSNBQBZSA-N |
| XLogP | 6.83 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.08 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|