C28H31ClN4O3 — CID 87419185
N-[(E)-[4-[2-[2-aminoethyl(cyclohexyl)amino]-2-oxoethyl]naphthalen-1-yl]methylideneamino]-3-chloro-4-hydroxybenzamide (PubChem CID 87419185) has the molecular formula C28H31ClN4O3 and a molecular weight of 507.03 g/mol. Its IUPAC name is N-[(E)-[4-[2-[2-aminoethyl(cyclohexyl)amino]-2-oxoethyl]naphthalen-1-yl]methylideneamino]-3-chloro-4-hydroxybenzamide.
| Compound Name | N-[(E)-[4-[2-[2-aminoethyl(cyclohexyl)amino]-2-oxoethyl]naphthalen-1-yl]methylideneamino]-3-chloro-4-hydroxybenzamide |
|---|---|
| PubChem CID | 87419185 |
| Molecular Formula | C28H31ClN4O3 |
| Molecular Weight | 507.03 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | N-[(E)-[4-[2-[2-aminoethyl(cyclohexyl)amino]-2-oxoethyl]naphthalen-1-yl]methylideneamino]-3-chloro-4-hydroxybenzamide |
| SMILES | NCCN(C(=O)Cc1ccc(/C=N/NC(=O)c2ccc(O)c(Cl)c2)c2ccccc12)C1CCCCC1 |
| InChI | InChI=1S/C28H31ClN4O3/c29-25-16-20(12-13-26(25)34)28(36)32-31-18-21-11-10-19(23-8-4-5-9-24(21)23)17-27(35)33(15-14-30)22-6-2-1-3-7-22/h4-5,8-13,16,18,22,34H,1-3,6-7,14-15,17,30H2,(H,32,36)/b31-18+ |
| InChIKey | RYKYQRSSEZRTQU-FDAWAROLSA-N |
| XLogP | 4.63 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.03 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|